C28H14F6N2O6 — CID 141169978
1-[2-[5-[2-(2,5-dioxopyrrol-1-yl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]phenyl]pyrrole-2,5-dione (PubChem CID 141169978) has the molecular formula C28H14F6N2O6 and a molecular weight of 588.42 g/mol. Its IUPAC name is 1-[2-[5-[2-(2,5-dioxopyrrol-1-yl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[5-[2-(2,5-dioxopyrrol-1-yl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 141169978 |
| Molecular Formula | C28H14F6N2O6 |
| Molecular Weight | 588.42 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | 1-[2-[5-[2-(2,5-dioxopyrrol-1-yl)phenoxy]-2,4-bis(trifluoromethyl)phenoxy]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccccc1Oc1cc(Oc2ccccc2N2C(=O)C=CC2=O)c(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C28H14F6N2O6/c29-27(30,31)15-13-16(28(32,33)34)22(42-20-8-4-2-6-18(20)36-25(39)11-12-26(36)40)14-21(15)41-19-7-3-1-5-17(19)35-23(37)9-10-24(35)38/h1-14H |
| InChIKey | FFJPRHPDEYWSQI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|