About 4-phenyl-5H-dioxazole
4-phenyl-5H-dioxazole (PubChem CID 141170538) has the molecular formula C8H7NO2
and a molecular weight of 149.15 g/mol. Its IUPAC name is 4-phenyl-5H-dioxazole.
Molecular Properties
| Compound Name | 4-phenyl-5H-dioxazole |
| PubChem CID | 141170538 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 4-phenyl-5H-dioxazole |
| SMILES | c1ccc(C2=NOOC2)cc1 |
| InChI | InChI=1S/C8H7NO2/c1-2-4-7(5-3-1)8-6-10-11-9-8/h1-5H,6H2 |
| InChIKey | XCPQFJSJEQTXRD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-5H-dioxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-5H-dioxazole?
The IUPAC name of 4-phenyl-5H-dioxazole (CID 141170538) is 4-phenyl-5H-dioxazole.
What is the SMILES notation for 4-phenyl-5H-dioxazole?
The canonical SMILES for 4-phenyl-5H-dioxazole is c1ccc(C2=NOOC2)cc1.
What is the InChIKey of 4-phenyl-5H-dioxazole?
The InChIKey is XCPQFJSJEQTXRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2/c1-2-4-7(5-3-1)8-6-10-11-9-8/h1-5H,6H2.
What are the key properties of 4-phenyl-5H-dioxazole?
4-phenyl-5H-dioxazole has a molecular weight of 149.15 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-5H-dioxazole is sourced from PubChem (CID 141170538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).