C17H11F4N3O2S2 — CID 141171244
5-fluoro-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylindole (PubChem CID 141171244) has the molecular formula C17H11F4N3O2S2 and a molecular weight of 429.42 g/mol. Its IUPAC name is 5-fluoro-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylindole.
| Compound Name | 5-fluoro-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylindole |
|---|---|
| PubChem CID | 141171244 |
| Molecular Formula | C17H11F4N3O2S2 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 5-fluoro-1-[5-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]sulfonylindole |
| SMILES | Cn1nc(-c2ccc(S(=O)(=O)n3ccc4cc(F)ccc43)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H11F4N3O2S2/c1-23-15(17(19,20)21)9-12(22-23)14-4-5-16(27-14)28(25,26)24-7-6-10-8-11(18)2-3-13(10)24/h2-9H,1H3 |
| InChIKey | IFIAMAJJILRACY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |