C13H22O11 — CID 141172074
bis[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]methanone (PubChem CID 141172074) has the molecular formula C13H22O11 and a molecular weight of 354.31 g/mol. Its IUPAC name is bis[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]methanone.
| Compound Name | bis[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 141172074 |
| Molecular Formula | C13H22O11 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | bis[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]methanone |
| SMILES | O=C(C1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O)C1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H22O11/c14-1-5-7(18)9(20)12(3-16,23-5)11(22)13(4-17)10(21)8(19)6(2-15)24-13/h5-10,14-21H,1-4H2/t5-,6-,7-,8-,9+,10+,12?,13?/m1/s1 |
| InChIKey | NSTJWPWQUHYGCY-WFKILLDSSA-N |
| XLogP | -5.76 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | -5.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |