About 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride
1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride (PubChem CID 141172318) has the molecular formula C14H18ClNO2
and a molecular weight of 267.76 g/mol. Its IUPAC name is 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride.
Molecular Properties
| Compound Name | 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride |
| PubChem CID | 141172318 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride |
| SMILES | CON1C(=O)C2(CCCCC2)c2ccccc21.Cl |
| InChI | InChI=1S/C14H17NO2.ClH/c1-17-15-12-8-4-3-7-11(12)14(13(15)16)9-5-2-6-10-14;/h3-4,7-8H,2,5-6,9-10H2,1H3;1H |
| InChIKey | HKOHBPZMTLDKON-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride?
The IUPAC name of 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride (CID 141172318) is 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride.
What is the SMILES notation for 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride?
The canonical SMILES for 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride is CON1C(=O)C2(CCCCC2)c2ccccc21.Cl.
What is the InChIKey of 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride?
The InChIKey is HKOHBPZMTLDKON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2.ClH/c1-17-15-12-8-4-3-7-11(12)14(13(15)16)9-5-2-6-10-14;/h3-4,7-8H,2,5-6,9-10H2,1H3;1H.
What are the key properties of 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride?
1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride has a molecular weight of 267.76 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methoxyspiro[cyclohexane-1,3'-indole]-2'-one;hydrochloride is sourced from PubChem (CID 141172318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).