C12H20O8 — CID 141172391
(3R,4S)-3-deuteriocarbonyl-4-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-1,6-dimethoxy-3-methylhexane-2,5-dione (PubChem CID 141172391) has the molecular formula C12H20O8 and a molecular weight of 293.29 g/mol. Its IUPAC name is (3R,4S)-3-deuteriocarbonyl-4-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-1,6-dimethoxy-3-methylhexane-2,5-dione.
| Compound Name | (3R,4S)-3-deuteriocarbonyl-4-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-1,6-dimethoxy-3-methylhexane-2,5-dione |
|---|---|
| PubChem CID | 141172391 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (3R,4S)-3-deuteriocarbonyl-4-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-1,6-dimethoxy-3-methylhexane-2,5-dione |
| SMILES | [2H]C(=O)[C@](C)(C(=O)COC)[C@@](O)(C(=O)COC)[C@H](O)CO |
| InChI | InChI=1S/C12H20O8/c1-11(7-14,9(16)5-19-2)12(18,8(15)4-13)10(17)6-20-3/h7-8,13,15,18H,4-6H2,1-3H3/t8-,11-,12+/m1/s1/i7D |
| InChIKey | UITZWAAAVMYXAW-UDBJWPEWSA-N |
| XLogP | -2.29 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|