C12H18F6O4S — CID 141172564
3-fluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid (PubChem CID 141172564) has the molecular formula C12H18F6O4S and a molecular weight of 372.33 g/mol. Its IUPAC name is 3-fluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid.
| Compound Name | 3-fluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid |
|---|---|
| PubChem CID | 141172564 |
| Molecular Formula | C12H18F6O4S |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-fluoro-2-methyl-2-(3,3,4,4,4-pentafluorobutylsulfonyl)heptanoic acid |
| SMILES | CCCCC(F)C(C)(C(=O)O)S(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6O4S/c1-3-4-5-8(13)10(2,9(19)20)23(21,22)7-6-11(14,15)12(16,17)18/h8H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | KONGFWHYZQGDIZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|