C10H15NO — CID 141172684
1-methyl-1,2,3,6,9,9a-hexahydroquinolizin-4-one (PubChem CID 141172684) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-methyl-1,2,3,6,9,9a-hexahydroquinolizin-4-one.
| Compound Name | 1-methyl-1,2,3,6,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 141172684 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 1-methyl-1,2,3,6,9,9a-hexahydroquinolizin-4-one |
| SMILES | CC1CCC(=O)N2CC=CCC12 |
| InChI | InChI=1S/C10H15NO/c1-8-5-6-10(12)11-7-3-2-4-9(8)11/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | YNRBKWDAVIAEEV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|