C19H27N3O4 — CID 141172781
ethyl 3-nitro-2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzoate (PubChem CID 141172781) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl 3-nitro-2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzoate.
| Compound Name | ethyl 3-nitro-2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzoate |
|---|---|
| PubChem CID | 141172781 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethyl 3-nitro-2-[[(1S,2S)-2-pyrrolidin-1-ylcyclohexyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc([N+](=O)[O-])c1N[C@H]1CCCC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C19H27N3O4/c1-2-26-19(23)14-8-7-11-17(22(24)25)18(14)20-15-9-3-4-10-16(15)21-12-5-6-13-21/h7-8,11,15-16,20H,2-6,9-10,12-13H2,1H3/t15-,16-/m0/s1 |
| InChIKey | BVQXSDMKFKHXFL-HOTGVXAUSA-N |
| XLogP | 3.59 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|