C13H17NO2 — CID 141173074
1-ethyl-4,4,6-trimethyl-3,1-benzoxazin-2-one (PubChem CID 141173074) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-ethyl-4,4,6-trimethyl-3,1-benzoxazin-2-one.
| Compound Name | 1-ethyl-4,4,6-trimethyl-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 141173074 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-ethyl-4,4,6-trimethyl-3,1-benzoxazin-2-one |
| SMILES | CCN1C(=O)OC(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C13H17NO2/c1-5-14-11-7-6-9(2)8-10(11)13(3,4)16-12(14)15/h6-8H,5H2,1-4H3 |
| InChIKey | BMNCZGQEJDHSEH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |