C18H23F3N2O — CID 141173405
5-(1-propan-2-ylpiperidin-4-yl)oxy-1-(2,2,2-trifluoroethyl)indole (PubChem CID 141173405) has the molecular formula C18H23F3N2O and a molecular weight of 340.39 g/mol. Its IUPAC name is 5-(1-propan-2-ylpiperidin-4-yl)oxy-1-(2,2,2-trifluoroethyl)indole.
| Compound Name | 5-(1-propan-2-ylpiperidin-4-yl)oxy-1-(2,2,2-trifluoroethyl)indole |
|---|---|
| PubChem CID | 141173405 |
| Molecular Formula | C18H23F3N2O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 5-(1-propan-2-ylpiperidin-4-yl)oxy-1-(2,2,2-trifluoroethyl)indole |
| SMILES | CC(C)N1CCC(Oc2ccc3c(ccn3CC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H23F3N2O/c1-13(2)22-9-6-15(7-10-22)24-16-3-4-17-14(11-16)5-8-23(17)12-18(19,20)21/h3-5,8,11,13,15H,6-7,9-10,12H2,1-2H3 |
| InChIKey | SZYLTEMRKGFAHV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |