C21H27FN4O2 — CID 141173677
4-[[2-fluoro-4-[1-(3-methoxypropyl)-2,3-dihydroimidazo[4,5-b]pyridin-2-yl]phenyl]methyl]morpholine (PubChem CID 141173677) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-[[2-fluoro-4-[1-(3-methoxypropyl)-2,3-dihydroimidazo[4,5-b]pyridin-2-yl]phenyl]methyl]morpholine.
| Compound Name | 4-[[2-fluoro-4-[1-(3-methoxypropyl)-2,3-dihydroimidazo[4,5-b]pyridin-2-yl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 141173677 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-[[2-fluoro-4-[1-(3-methoxypropyl)-2,3-dihydroimidazo[4,5-b]pyridin-2-yl]phenyl]methyl]morpholine |
| SMILES | COCCCN1c2cccnc2NC1c1ccc(CN2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C21H27FN4O2/c1-27-11-3-8-26-19-4-2-7-23-20(19)24-21(26)16-5-6-17(18(22)14-16)15-25-9-12-28-13-10-25/h2,4-7,14,21H,3,8-13,15H2,1H3,(H,23,24) |
| InChIKey | WTYCCHAEJKRDMX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|