About 2,3-dihydroxy-1,2-dihydropyrimidin-6-one
2,3-dihydroxy-1,2-dihydropyrimidin-6-one (PubChem CID 141173753) has the molecular formula C4H6N2O3
and a molecular weight of 130.10 g/mol. Its IUPAC name is 2,3-dihydroxy-1,2-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 2,3-dihydroxy-1,2-dihydropyrimidin-6-one |
| PubChem CID | 141173753 |
| Molecular Formula | C4H6N2O3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 2,3-dihydroxy-1,2-dihydropyrimidin-6-one |
| SMILES | O=C1C=CN(O)C(O)N1 |
| InChI | InChI=1S/C4H6N2O3/c7-3-1-2-6(9)4(8)5-3/h1-2,4,8-9H,(H,5,7) |
| InChIKey | XEUGJEOXCRDBMA-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydroxy-1,2-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-1,2-dihydropyrimidin-6-one?
The IUPAC name of 2,3-dihydroxy-1,2-dihydropyrimidin-6-one (CID 141173753) is 2,3-dihydroxy-1,2-dihydropyrimidin-6-one.
What is the SMILES notation for 2,3-dihydroxy-1,2-dihydropyrimidin-6-one?
The canonical SMILES for 2,3-dihydroxy-1,2-dihydropyrimidin-6-one is O=C1C=CN(O)C(O)N1.
What is the InChIKey of 2,3-dihydroxy-1,2-dihydropyrimidin-6-one?
The InChIKey is XEUGJEOXCRDBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3/c7-3-1-2-6(9)4(8)5-3/h1-2,4,8-9H,(H,5,7).
What are the key properties of 2,3-dihydroxy-1,2-dihydropyrimidin-6-one?
2,3-dihydroxy-1,2-dihydropyrimidin-6-one has a molecular weight of 130.10 g/mol, XLogP of -1.40, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-1,2-dihydropyrimidin-6-one is sourced from PubChem (CID 141173753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).