C17H23N3O4 — CID 141173912
3,3-dimethyl-1-(3-morpholin-4-ylpropyl)-5-nitroindol-2-one (PubChem CID 141173912) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-morpholin-4-ylpropyl)-5-nitroindol-2-one.
| Compound Name | 3,3-dimethyl-1-(3-morpholin-4-ylpropyl)-5-nitroindol-2-one |
|---|---|
| PubChem CID | 141173912 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3,3-dimethyl-1-(3-morpholin-4-ylpropyl)-5-nitroindol-2-one |
| SMILES | CC1(C)C(=O)N(CCCN2CCOCC2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H23N3O4/c1-17(2)14-12-13(20(22)23)4-5-15(14)19(16(17)21)7-3-6-18-8-10-24-11-9-18/h4-5,12H,3,6-11H2,1-2H3 |
| InChIKey | XJVJRQLHBPYHJM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|