About 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine
1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine (PubChem CID 141173995) has the molecular formula C23H27Cl3N2
and a molecular weight of 437.84 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine.
Molecular Properties
| Compound Name | 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine |
| PubChem CID | 141173995 |
| Molecular Formula | C23H27Cl3N2 |
| Molecular Weight | 437.84 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2Cl)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H27Cl3N2/c24-18-8-6-17(7-9-18)23(21-11-10-19(25)16-22(21)26)28-14-12-27(13-15-28)20-4-2-1-3-5-20/h6-11,16,20,23H,1-5,12-15H2 |
| InChIKey | VFHRZCHAHAGXMH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.84 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine?
The IUPAC name of 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine (CID 141173995) is 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine.
What is the SMILES notation for 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine?
The canonical SMILES for 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine is Clc1ccc(C(c2ccc(Cl)cc2Cl)N2CCN(C3CCCCC3)CC2)cc1.
What is the InChIKey of 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine?
The InChIKey is VFHRZCHAHAGXMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27Cl3N2/c24-18-8-6-17(7-9-18)23(21-11-10-19(25)16-22(21)26)28-14-12-27(13-15-28)20-4-2-1-3-5-20/h6-11,16,20,23H,1-5,12-15H2.
What are the key properties of 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine?
1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine has a molecular weight of 437.84 g/mol, XLogP of 6.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chlorophenyl)-(2,4-dichlorophenyl)methyl]-4-cyclohexylpiperazine is sourced from PubChem (CID 141173995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).