C23H17NO2S2 — CID 141174094
2,3-bis[furan-2-yl(thiophen-2-yl)methyl]pyridine (PubChem CID 141174094) has the molecular formula C23H17NO2S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2,3-bis[furan-2-yl(thiophen-2-yl)methyl]pyridine.
| Compound Name | 2,3-bis[furan-2-yl(thiophen-2-yl)methyl]pyridine |
|---|---|
| PubChem CID | 141174094 |
| Molecular Formula | C23H17NO2S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2,3-bis[furan-2-yl(thiophen-2-yl)methyl]pyridine |
| SMILES | c1coc(C(c2cccs2)c2cccnc2C(c2ccco2)c2cccs2)c1 |
| InChI | InChI=1S/C23H17NO2S2/c1-6-16(21(17-7-2-12-25-17)19-9-4-14-27-19)23(24-11-1)22(18-8-3-13-26-18)20-10-5-15-28-20/h1-15,21-22H |
| InChIKey | IIHYWCVFWLYACG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |