About 2,2-diiodomorpholine
2,2-diiodomorpholine (PubChem CID 141174185) has the molecular formula C4H7I2NO
and a molecular weight of 338.91 g/mol. Its IUPAC name is 2,2-diiodomorpholine.
Molecular Properties
| Compound Name | 2,2-diiodomorpholine |
| PubChem CID | 141174185 |
| Molecular Formula | C4H7I2NO |
| Molecular Weight | 338.91 g/mol |
| Exact Mass | 338.86 |
| IUPAC Name | 2,2-diiodomorpholine |
| SMILES | IC1(I)CNCCO1 |
| InChI | InChI=1S/C4H7I2NO/c5-4(6)3-7-1-2-8-4/h7H,1-3H2 |
| InChIKey | AUUSQUXDCRYRHJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.91 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diiodomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diiodomorpholine?
The IUPAC name of 2,2-diiodomorpholine (CID 141174185) is 2,2-diiodomorpholine.
What is the SMILES notation for 2,2-diiodomorpholine?
The canonical SMILES for 2,2-diiodomorpholine is IC1(I)CNCCO1.
What is the InChIKey of 2,2-diiodomorpholine?
The InChIKey is AUUSQUXDCRYRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7I2NO/c5-4(6)3-7-1-2-8-4/h7H,1-3H2.
What are the key properties of 2,2-diiodomorpholine?
2,2-diiodomorpholine has a molecular weight of 338.91 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diiodomorpholine is sourced from PubChem (CID 141174185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).