C10H13N3S2 — CID 141175193
3-[(E)-2-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]ethenyl]-2H-1,2,4-thiadiazole-5-thione (PubChem CID 141175193) has the molecular formula C10H13N3S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is 3-[(E)-2-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]ethenyl]-2H-1,2,4-thiadiazole-5-thione.
| Compound Name | 3-[(E)-2-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]ethenyl]-2H-1,2,4-thiadiazole-5-thione |
|---|---|
| PubChem CID | 141175193 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-[(E)-2-[(6R)-6-methyl-1,2,3,6-tetrahydropyridin-4-yl]ethenyl]-2H-1,2,4-thiadiazole-5-thione |
| SMILES | C[C@@H]1C=C(/C=C/c2nc(=S)s[nH]2)CCN1 |
| InChI | InChI=1S/C10H13N3S2/c1-7-6-8(4-5-11-7)2-3-9-12-10(14)15-13-9/h2-3,6-7,11H,4-5H2,1H3,(H,12,13,14)/b3-2+/t7-/m1/s1 |
| InChIKey | XDLXXGWPCGKPNK-TYWZFMJISA-N |
| XLogP | 2.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|