C7H9N3S2 — CID 141175219
3-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]-2H-1,2,4-thiadiazole-5-thione (PubChem CID 141175219) has the molecular formula C7H9N3S2 and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]-2H-1,2,4-thiadiazole-5-thione.
| Compound Name | 3-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]-2H-1,2,4-thiadiazole-5-thione |
|---|---|
| PubChem CID | 141175219 |
| Molecular Formula | C7H9N3S2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 3-[(5R)-5-methyl-2,5-dihydro-1H-pyrrol-3-yl]-2H-1,2,4-thiadiazole-5-thione |
| SMILES | C[C@@H]1C=C(c2nc(=S)s[nH]2)CN1 |
| InChI | InChI=1S/C7H9N3S2/c1-4-2-5(3-8-4)6-9-7(11)12-10-6/h2,4,8H,3H2,1H3,(H,9,10,11)/t4-/m1/s1 |
| InChIKey | JDGNPTPTXQVVCD-SCSAIBSYSA-N |
| XLogP | 1.58 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|