About 2-prop-2-enoyloxypropyl 2-methylbutanoate
2-prop-2-enoyloxypropyl 2-methylbutanoate (PubChem CID 141176089) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-prop-2-enoyloxypropyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxypropyl 2-methylbutanoate |
| PubChem CID | 141176089 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-prop-2-enoyloxypropyl 2-methylbutanoate |
| SMILES | C=CC(=O)OC(C)COC(=O)C(C)CC |
| InChI | InChI=1S/C11H18O4/c1-5-8(3)11(13)14-7-9(4)15-10(12)6-2/h6,8-9H,2,5,7H2,1,3-4H3 |
| InChIKey | NYVQSBDASFBVQC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxypropyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxypropyl 2-methylbutanoate?
The IUPAC name of 2-prop-2-enoyloxypropyl 2-methylbutanoate (CID 141176089) is 2-prop-2-enoyloxypropyl 2-methylbutanoate.
What is the SMILES notation for 2-prop-2-enoyloxypropyl 2-methylbutanoate?
The canonical SMILES for 2-prop-2-enoyloxypropyl 2-methylbutanoate is C=CC(=O)OC(C)COC(=O)C(C)CC.
What is the InChIKey of 2-prop-2-enoyloxypropyl 2-methylbutanoate?
The InChIKey is NYVQSBDASFBVQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-5-8(3)11(13)14-7-9(4)15-10(12)6-2/h6,8-9H,2,5,7H2,1,3-4H3.
What are the key properties of 2-prop-2-enoyloxypropyl 2-methylbutanoate?
2-prop-2-enoyloxypropyl 2-methylbutanoate has a molecular weight of 214.26 g/mol, XLogP of 1.69, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxypropyl 2-methylbutanoate is sourced from PubChem (CID 141176089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).