C20H18N2O4S — CID 141176196
ethyl 2-[4-methyl-2-(4-nitrophenyl)-1,5-benzothiazepin-3-ylidene]acetate (PubChem CID 141176196) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is ethyl 2-[4-methyl-2-(4-nitrophenyl)-1,5-benzothiazepin-3-ylidene]acetate.
| Compound Name | ethyl 2-[4-methyl-2-(4-nitrophenyl)-1,5-benzothiazepin-3-ylidene]acetate |
|---|---|
| PubChem CID | 141176196 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | ethyl 2-[4-methyl-2-(4-nitrophenyl)-1,5-benzothiazepin-3-ylidene]acetate |
| SMILES | CCOC(=O)C=C1C(C)=Nc2ccccc2SC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H18N2O4S/c1-3-26-19(23)12-16-13(2)21-17-6-4-5-7-18(17)27-20(16)14-8-10-15(11-9-14)22(24)25/h4-12,20H,3H2,1-2H3 |
| InChIKey | AHINXWYCLPOLBI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|