C16H26O2 — CID 141176666
ethyl tetradeca-4,8,12-trienoate (PubChem CID 141176666) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is ethyl tetradeca-4,8,12-trienoate.
| Compound Name | ethyl tetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 141176666 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | ethyl tetradeca-4,8,12-trienoate |
| SMILES | CC=CCCC=CCCC=CCCC(=O)OCC |
| InChI | InChI=1S/C16H26O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)18-4-2/h3,5,8-9,12-13H,4,6-7,10-11,14-15H2,1-2H3 |
| InChIKey | KOLKLWAIWKEDLW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|