About 1-trityl-1,2,4-triazole-3-carboxamide
1-trityl-1,2,4-triazole-3-carboxamide (PubChem CID 141176875) has the molecular formula C22H18N4O
and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-trityl-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-trityl-1,2,4-triazole-3-carboxamide |
| PubChem CID | 141176875 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-trityl-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C22H18N4O/c23-20(27)21-24-16-26(25-21)22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H,(H2,23,27) |
| InChIKey | WRUIJSCASSJCNY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-trityl-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trityl-1,2,4-triazole-3-carboxamide?
The IUPAC name of 1-trityl-1,2,4-triazole-3-carboxamide (CID 141176875) is 1-trityl-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 1-trityl-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 1-trityl-1,2,4-triazole-3-carboxamide is NC(=O)c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of 1-trityl-1,2,4-triazole-3-carboxamide?
The InChIKey is WRUIJSCASSJCNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N4O/c23-20(27)21-24-16-26(25-21)22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H,(H2,23,27).
What are the key properties of 1-trityl-1,2,4-triazole-3-carboxamide?
1-trityl-1,2,4-triazole-3-carboxamide has a molecular weight of 354.41 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trityl-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 141176875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).