C67H37N13O — CID 141178005
2-(9H-carbazol-1-yl)-1-phenazin-1-yl-3-pteridin-2-yl-4-quinazolin-2-yl-7-quinolin-2-yl-6-quinoxalin-2-yl-10H-phenoxazine (PubChem CID 141178005) has the molecular formula C67H37N13O and a molecular weight of 1040.12 g/mol. Its IUPAC name is 2-(9H-carbazol-1-yl)-1-phenazin-1-yl-3-pteridin-2-yl-4-quinazolin-2-yl-7-quinolin-2-yl-6-quinoxalin-2-yl-10H-phenoxazine.
| Compound Name | 2-(9H-carbazol-1-yl)-1-phenazin-1-yl-3-pteridin-2-yl-4-quinazolin-2-yl-7-quinolin-2-yl-6-quinoxalin-2-yl-10H-phenoxazine |
|---|---|
| PubChem CID | 141178005 |
| Molecular Formula | C67H37N13O |
| Molecular Weight | 1040.12 g/mol |
| Exact Mass | 1039.32 |
| IUPAC Name | 2-(9H-carbazol-1-yl)-1-phenazin-1-yl-3-pteridin-2-yl-4-quinazolin-2-yl-7-quinolin-2-yl-6-quinoxalin-2-yl-10H-phenoxazine |
| SMILES | c1ccc2nc(-c3ccc4c(c3-c3cnc5ccccc5n3)Oc3c(c(-c5cccc6nc7ccccc7nc56)c(-c5cccc6c5[nH]c5ccccc56)c(-c5ncc6nccnc6n5)c3-c3ncc5ccccc5n3)N4)ccc2c1 |
| InChI | InChI=1S/C67H37N13O/c1-4-19-43-36(13-1)27-29-46(73-43)40-28-30-52-63(55(40)53-34-70-47-22-7-8-23-48(47)75-53)81-64-59(67-71-33-37-14-2-5-20-44(37)79-67)58(66-72-35-54-65(80-66)69-32-31-68-54)56(41-17-11-16-39-38-15-3-6-21-45(38)76-60(39)41)57(62(64)78-52)42-18-12-26-51-61(42)77-50-25-10-9-24-49(50)74-51/h1-35,76,78H |
| InChIKey | QRVLMFGYTRASQO-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 178.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1040.12 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|