About 4-cyclohexa-2,4-dien-1-ylpyridine
4-cyclohexa-2,4-dien-1-ylpyridine (PubChem CID 141178072) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-ylpyridine.
Molecular Properties
| Compound Name | 4-cyclohexa-2,4-dien-1-ylpyridine |
| PubChem CID | 141178072 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-ylpyridine |
| SMILES | C1=CCC(c2ccncc2)C=C1 |
| InChI | InChI=1S/C11H11N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-4,6-10H,5H2 |
| InChIKey | BNBYWIGACVAIKB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexa-2,4-dien-1-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-2,4-dien-1-ylpyridine?
The IUPAC name of 4-cyclohexa-2,4-dien-1-ylpyridine (CID 141178072) is 4-cyclohexa-2,4-dien-1-ylpyridine.
What is the SMILES notation for 4-cyclohexa-2,4-dien-1-ylpyridine?
The canonical SMILES for 4-cyclohexa-2,4-dien-1-ylpyridine is C1=CCC(c2ccncc2)C=C1.
What is the InChIKey of 4-cyclohexa-2,4-dien-1-ylpyridine?
The InChIKey is BNBYWIGACVAIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h1-4,6-10H,5H2.
What are the key properties of 4-cyclohexa-2,4-dien-1-ylpyridine?
4-cyclohexa-2,4-dien-1-ylpyridine has a molecular weight of 157.22 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-2,4-dien-1-ylpyridine is sourced from PubChem (CID 141178072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).