About 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide
6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide (PubChem CID 14117903) has the molecular formula C7H11Cl2OP
and a molecular weight of 213.04 g/mol. Its IUPAC name is 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide.
Molecular Properties
| Compound Name | 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide |
| PubChem CID | 14117903 |
| Molecular Formula | C7H11Cl2OP |
| Molecular Weight | 213.04 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide |
| SMILES | CC12CP(C)(=O)CC1C2(Cl)Cl |
| InChI | InChI=1S/C7H11Cl2OP/c1-6-4-11(2,10)3-5(6)7(6,8)9/h5H,3-4H2,1-2H3 |
| InChIKey | RLCKEOKDLFGREO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.04 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide?
The IUPAC name of 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide (CID 14117903) is 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide.
What is the SMILES notation for 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide?
The canonical SMILES for 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide is CC12CP(C)(=O)CC1C2(Cl)Cl.
What is the InChIKey of 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide?
The InChIKey is RLCKEOKDLFGREO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11Cl2OP/c1-6-4-11(2,10)3-5(6)7(6,8)9/h5H,3-4H2,1-2H3.
What are the key properties of 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide?
6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide has a molecular weight of 213.04 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dichloro-1,3-dimethyl-3λ5-phosphabicyclo[3.1.0]hexane 3-oxide is sourced from PubChem (CID 14117903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).