C10H12N4O5 — CID 141179168
methyl (3R,4S)-3-acetamido-4-azido-2-formyl-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 141179168) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is methyl (3R,4S)-3-acetamido-4-azido-2-formyl-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (3R,4S)-3-acetamido-4-azido-2-formyl-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 141179168 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | methyl (3R,4S)-3-acetamido-4-azido-2-formyl-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](NC(C)=O)C(C=O)O1 |
| InChI | InChI=1S/C10H12N4O5/c1-5(16)12-9-6(13-14-11)3-7(10(17)18-2)19-8(9)4-15/h3-4,6,8-9H,1-2H3,(H,12,16)/t6-,8?,9+/m0/s1 |
| InChIKey | VKVBJXFHUMYEPV-WGQGIHMKSA-N |
| XLogP | -0.18 |
| TPSA | 130.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|