C17H18FNO3 — CID 141179942
4-[2-(4-fluorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylic acid (PubChem CID 141179942) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylic acid.
| Compound Name | 4-[2-(4-fluorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylic acid |
|---|---|
| PubChem CID | 141179942 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethynyl]-4-hydroxy-3,3a,5,6,7,7a-hexahydro-2H-indole-1-carboxylic acid |
| SMILES | O=C(O)N1CCC2C1CCCC2(O)C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO3/c18-13-5-3-12(4-6-13)7-10-17(22)9-1-2-15-14(17)8-11-19(15)16(20)21/h3-6,14-15,22H,1-2,8-9,11H2,(H,20,21) |
| InChIKey | ZBABMFJNUFUBNY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|