C22H20N2O3 — CID 141180163
3-benzoyl-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxylic acid (PubChem CID 141180163) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-benzoyl-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxylic acid.
| Compound Name | 3-benzoyl-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 141180163 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-benzoyl-1,1-dimethyl-2,6-dihydroazepino[4,5-b]indole-5-carboxylic acid |
| SMILES | CC1(C)CN(C(=O)c2ccccc2)C=C(C(=O)O)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C22H20N2O3/c1-22(2)13-24(20(25)14-8-4-3-5-9-14)12-16(21(26)27)19-18(22)15-10-6-7-11-17(15)23-19/h3-12,23H,13H2,1-2H3,(H,26,27) |
| InChIKey | SRJLKXGYAAJFKN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |