About 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole
2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 141180411) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole.
Molecular Properties
| Compound Name | 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole |
| PubChem CID | 141180411 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CCCC1Oc2c[nH]cc2O1 |
| InChI | InChI=1S/C8H11NO2/c1-2-3-8-10-6-4-9-5-7(6)11-8/h4-5,8-9H,2-3H2,1H3 |
| InChIKey | XQEJDDRKGDMYPM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole?
The IUPAC name of 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole (CID 141180411) is 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole.
What is the SMILES notation for 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole?
The canonical SMILES for 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole is CCCC1Oc2c[nH]cc2O1.
What is the InChIKey of 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole?
The InChIKey is XQEJDDRKGDMYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-2-3-8-10-6-4-9-5-7(6)11-8/h4-5,8-9H,2-3H2,1H3.
What are the key properties of 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole?
2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole has a molecular weight of 153.18 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-5H-[1,3]dioxolo[4,5-c]pyrrole is sourced from PubChem (CID 141180411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).