C17H11BrF9NO — CID 141180560
2-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]methyl]-6-bromo-4-(trifluoromethyl)phenol (PubChem CID 141180560) has the molecular formula C17H11BrF9NO and a molecular weight of 496.17 g/mol. Its IUPAC name is 2-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]methyl]-6-bromo-4-(trifluoromethyl)phenol.
| Compound Name | 2-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]methyl]-6-bromo-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 141180560 |
| Molecular Formula | C17H11BrF9NO |
| Molecular Weight | 496.17 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | 2-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]methyl]-6-bromo-4-(trifluoromethyl)phenol |
| SMILES | Oc1c(Br)cc(C(F)(F)F)cc1CNCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11BrF9NO/c18-13-5-12(17(25,26)27)3-9(14(13)29)7-28-6-8-1-10(15(19,20)21)4-11(2-8)16(22,23)24/h1-5,28-29H,6-7H2 |
| InChIKey | VVMCANRYQWDUBN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.17 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|