About diethyl(methyl)sulfanium tetrafluoroborate
diethyl(methyl)sulfanium tetrafluoroborate (PubChem CID 141180949) has the molecular formula C5H13BF4S
and a molecular weight of 192.03 g/mol. Its IUPAC name is diethyl(methyl)sulfanium tetrafluoroborate.
Molecular Properties
| Compound Name | diethyl(methyl)sulfanium tetrafluoroborate |
| PubChem CID | 141180949 |
| Molecular Formula | C5H13BF4S |
| Molecular Weight | 192.03 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | diethyl(methyl)sulfanium tetrafluoroborate |
| SMILES | CC[S+](C)CC.F[B-](F)(F)F |
| InChI | InChI=1S/C5H13S.BF4/c1-4-6(3)5-2;2-1(3,4)5/h4-5H2,1-3H3;/q+1;-1 |
| InChIKey | DYCDXZSJPPUCHV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.03 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyl(methyl)sulfanium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(methyl)sulfanium tetrafluoroborate?
The IUPAC name of diethyl(methyl)sulfanium tetrafluoroborate (CID 141180949) is diethyl(methyl)sulfanium tetrafluoroborate.
What is the SMILES notation for diethyl(methyl)sulfanium tetrafluoroborate?
The canonical SMILES for diethyl(methyl)sulfanium tetrafluoroborate is CC[S+](C)CC.F[B-](F)(F)F.
What is the InChIKey of diethyl(methyl)sulfanium tetrafluoroborate?
The InChIKey is DYCDXZSJPPUCHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13S.BF4/c1-4-6(3)5-2;2-1(3,4)5/h4-5H2,1-3H3;/q+1;-1.
What are the key properties of diethyl(methyl)sulfanium tetrafluoroborate?
diethyl(methyl)sulfanium tetrafluoroborate has a molecular weight of 192.03 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(methyl)sulfanium tetrafluoroborate is sourced from PubChem (CID 141180949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).