C17H17F3N4O — CID 141181204
5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine (PubChem CID 141181204) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine.
| Compound Name | 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine |
|---|---|
| PubChem CID | 141181204 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine |
| SMILES | COCCNc1ccc2nc(Nc3ccccc3C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C17H17F3N4O/c1-25-9-8-21-11-6-7-14-15(10-11)24-16(23-14)22-13-5-3-2-4-12(13)17(18,19)20/h2-7,10,21H,8-9H2,1H3,(H2,22,23,24) |
| InChIKey | NGXIFQPFPHPNHF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|