About 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine
5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine (PubChem CID 141181204) has the molecular formula C17H17F3N4O
and a molecular weight of 350.34 g/mol. Its IUPAC name is 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine |
| PubChem CID | 141181204 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine |
| SMILES | COCCNc1ccc2nc(Nc3ccccc3C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C17H17F3N4O/c1-25-9-8-21-11-6-7-14-15(10-11)24-16(23-14)22-13-5-3-2-4-12(13)17(18,19)20/h2-7,10,21H,8-9H2,1H3,(H2,22,23,24) |
| InChIKey | NGXIFQPFPHPNHF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine?
The IUPAC name of 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine (CID 141181204) is 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine.
What is the SMILES notation for 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine?
The canonical SMILES for 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine is COCCNc1ccc2nc(Nc3ccccc3C(F)(F)F)[nH]c2c1.
What is the InChIKey of 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine?
The InChIKey is NGXIFQPFPHPNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N4O/c1-25-9-8-21-11-6-7-14-15(10-11)24-16(23-14)22-13-5-3-2-4-12(13)17(18,19)20/h2-7,10,21H,8-9H2,1H3,(H2,22,23,24).
What are the key properties of 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine?
5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine has a molecular weight of 350.34 g/mol, XLogP of 4.38, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2-methoxyethyl)-2-N-[2-(trifluoromethyl)phenyl]-3H-benzimidazole-2,5-diamine is sourced from PubChem (CID 141181204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).