About 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole
2-(oxan-4-ylmethyl)-1,3,4-oxadiazole (PubChem CID 141181283) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole |
| PubChem CID | 141181283 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole |
| SMILES | c1nnc(CC2CCOCC2)o1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-11-4-2-7(1)5-8-10-9-6-12-8/h6-7H,1-5H2 |
| InChIKey | CERSPAFSXLADFN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole?
The IUPAC name of 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole (CID 141181283) is 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole is c1nnc(CC2CCOCC2)o1.
What is the InChIKey of 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole?
The InChIKey is CERSPAFSXLADFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-3-11-4-2-7(1)5-8-10-9-6-12-8/h6-7H,1-5H2.
What are the key properties of 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole?
2-(oxan-4-ylmethyl)-1,3,4-oxadiazole has a molecular weight of 168.20 g/mol, XLogP of 1.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-ylmethyl)-1,3,4-oxadiazole is sourced from PubChem (CID 141181283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).