C13H14F8O2 — CID 141181657
5-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1,2,2,4,5,5-octafluoropentan-3-ol (PubChem CID 141181657) has the molecular formula C13H14F8O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is 5-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1,2,2,4,5,5-octafluoropentan-3-ol.
| Compound Name | 5-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1,2,2,4,5,5-octafluoropentan-3-ol |
|---|---|
| PubChem CID | 141181657 |
| Molecular Formula | C13H14F8O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1,2,2,4,5,5-octafluoropentan-3-ol |
| SMILES | OC(C(F)C(F)(F)OCC1CC2C=CC1C2)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H14F8O2/c14-9(10(22)11(15,16)13(19,20)21)12(17,18)23-5-8-4-6-1-2-7(8)3-6/h1-2,6-10,22H,3-5H2 |
| InChIKey | JXGDLWCMBFODOO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|