C15H20Br2N4Si — CID 141181683
5-[(E)-1,2-dibromo-2-trimethylsilylethenyl]-4-(2-methylpyrrolidin-1-yl)pyrimidine-2-carbonitrile (PubChem CID 141181683) has the molecular formula C15H20Br2N4Si and a molecular weight of 444.25 g/mol. Its IUPAC name is 5-[(E)-1,2-dibromo-2-trimethylsilylethenyl]-4-(2-methylpyrrolidin-1-yl)pyrimidine-2-carbonitrile.
| Compound Name | 5-[(E)-1,2-dibromo-2-trimethylsilylethenyl]-4-(2-methylpyrrolidin-1-yl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 141181683 |
| Molecular Formula | C15H20Br2N4Si |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 5-[(E)-1,2-dibromo-2-trimethylsilylethenyl]-4-(2-methylpyrrolidin-1-yl)pyrimidine-2-carbonitrile |
| SMILES | CC1CCCN1c1nc(C#N)ncc1/C(Br)=C(\Br)[Si](C)(C)C |
| InChI | InChI=1S/C15H20Br2N4Si/c1-10-6-5-7-21(10)15-11(9-19-12(8-18)20-15)13(16)14(17)22(2,3)4/h9-10H,5-7H2,1-4H3/b14-13- |
| InChIKey | JJEIXJIALBUASH-YPKPFQOOSA-N |
| XLogP | 4.67 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|