C21H26ClN3O — CID 141181818
2-[3-chloro-4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3,4-dihydro-1H-isoquinolin-6-ol (PubChem CID 141181818) has the molecular formula C21H26ClN3O and a molecular weight of 371.91 g/mol. Its IUPAC name is 2-[3-chloro-4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3,4-dihydro-1H-isoquinolin-6-ol.
| Compound Name | 2-[3-chloro-4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3,4-dihydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 141181818 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-[3-chloro-4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3,4-dihydro-1H-isoquinolin-6-ol |
| SMILES | CN(C)C1CCN(c2ccc(N3CCc4cc(O)ccc4C3)cc2Cl)C1 |
| InChI | InChI=1S/C21H26ClN3O/c1-23(2)18-8-10-25(14-18)21-6-4-17(12-20(21)22)24-9-7-15-11-19(26)5-3-16(15)13-24/h3-6,11-12,18,26H,7-10,13-14H2,1-2H3 |
| InChIKey | DEUNTSJHDIHVSJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|