C17H20N2O — CID 141182208
2-oxa-5,12-diazatricyclo[13.2.2.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaene (PubChem CID 141182208) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-oxa-5,12-diazatricyclo[13.2.2.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaene.
| Compound Name | 2-oxa-5,12-diazatricyclo[13.2.2.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaene |
|---|---|
| PubChem CID | 141182208 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-oxa-5,12-diazatricyclo[13.2.2.16,10]icosa-1(18),6,8,10(20),15(19),16-hexaene |
| SMILES | c1cc2cc(c1)NCCOc1ccc(cc1)CCNC2 |
| InChI | InChI=1S/C17H20N2O/c1-2-15-12-16(3-1)19-10-11-20-17-6-4-14(5-7-17)8-9-18-13-15/h1-7,12,18-19H,8-11,13H2 |
| InChIKey | ZCNGYVHFKXJZGX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |