C19H24N2OSi — CID 141183525
trimethyl-[2-[(6-phenylindazol-1-yl)methoxy]ethyl]silane (PubChem CID 141183525) has the molecular formula C19H24N2OSi and a molecular weight of 324.50 g/mol. Its IUPAC name is trimethyl-[2-[(6-phenylindazol-1-yl)methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[(6-phenylindazol-1-yl)methoxy]ethyl]silane |
|---|---|
| PubChem CID | 141183525 |
| Molecular Formula | C19H24N2OSi |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | trimethyl-[2-[(6-phenylindazol-1-yl)methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ncc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C19H24N2OSi/c1-23(2,3)12-11-22-15-21-19-13-17(9-10-18(19)14-20-21)16-7-5-4-6-8-16/h4-10,13-14H,11-12,15H2,1-3H3 |
| InChIKey | HYTMCXFHBSVZSE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|