C15H19N5 — CID 141183978
2-N-[(1R)-5,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 141183978) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-N-[(1R)-5,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(1R)-5,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 141183978 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-N-[(1R)-5,6-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc2c(c1C)CCC[C@H]2Nc1ncnc(N)n1 |
| InChI | InChI=1S/C15H19N5/c1-9-6-7-12-11(10(9)2)4-3-5-13(12)19-15-18-8-17-14(16)20-15/h6-8,13H,3-5H2,1-2H3,(H3,16,17,18,19,20)/t13-/m1/s1 |
| InChIKey | YEXFLARPDIIFOS-CYBMUJFWSA-N |
| XLogP | 2.56 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |