C8H18O7 — CID 141184613
1,1,2,3-tetramethoxybutane-1,2,3-triol (PubChem CID 141184613) has the molecular formula C8H18O7 and a molecular weight of 226.22 g/mol. Its IUPAC name is 1,1,2,3-tetramethoxybutane-1,2,3-triol.
| Compound Name | 1,1,2,3-tetramethoxybutane-1,2,3-triol |
|---|---|
| PubChem CID | 141184613 |
| Molecular Formula | C8H18O7 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1,1,2,3-tetramethoxybutane-1,2,3-triol |
| SMILES | COC(C)(O)C(O)(OC)C(O)(OC)OC |
| InChI | InChI=1S/C8H18O7/c1-6(9,12-2)7(10,13-3)8(11,14-4)15-5/h9-11H,1-5H3 |
| InChIKey | FJZSFEKBJLSPPJ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|