C9H9NO4 — CID 141185038
methyl 3-[2-oxo-4-(oxomethylidene)pyrrolidin-3-yl]prop-2-enoate (PubChem CID 141185038) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is methyl 3-[2-oxo-4-(oxomethylidene)pyrrolidin-3-yl]prop-2-enoate.
| Compound Name | methyl 3-[2-oxo-4-(oxomethylidene)pyrrolidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 141185038 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | methyl 3-[2-oxo-4-(oxomethylidene)pyrrolidin-3-yl]prop-2-enoate |
| SMILES | COC(=O)C=CC1C(=O)NCC1=C=O |
| InChI | InChI=1S/C9H9NO4/c1-14-8(12)3-2-7-6(5-11)4-10-9(7)13/h2-3,7H,4H2,1H3,(H,10,13) |
| InChIKey | RFBMRSMKBKZRSR-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|