C26H18O8 — CID 141185122
5,6,7,8-tetramethoxypentacene-1,2,3,4-tetrone (PubChem CID 141185122) has the molecular formula C26H18O8 and a molecular weight of 458.42 g/mol. Its IUPAC name is 5,6,7,8-tetramethoxypentacene-1,2,3,4-tetrone.
| Compound Name | 5,6,7,8-tetramethoxypentacene-1,2,3,4-tetrone |
|---|---|
| PubChem CID | 141185122 |
| Molecular Formula | C26H18O8 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 5,6,7,8-tetramethoxypentacene-1,2,3,4-tetrone |
| SMILES | COc1cccc2cc3cc4cc5c(=O)c(=O)c(=O)c(=O)c5c(OC)c4c(OC)c3c(OC)c12 |
| InChI | InChI=1S/C26H18O8/c1-31-15-7-5-6-11-8-12-9-13-10-14-19(21(28)23(30)22(29)20(14)27)26(34-4)18(13)25(33-3)17(12)24(32-2)16(11)15/h5-10H,1-4H3 |
| InChIKey | RDKIZXAOBVSPQC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|