About 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine
4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 141185318) has the molecular formula C19H10Cl2F3N5
and a molecular weight of 436.22 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine |
| PubChem CID | 141185318 |
| Molecular Formula | C19H10Cl2F3N5 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(-c2ccc(Cl)c(Cl)c2)nc(-n2cnc(-c3cccnc3)c2)n1 |
| InChI | InChI=1S/C19H10Cl2F3N5/c20-13-4-3-11(6-14(13)21)15-7-17(19(22,23)24)28-18(27-15)29-9-16(26-10-29)12-2-1-5-25-8-12/h1-10H |
| InChIKey | HJOHWVOSWVTEHJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine (CID 141185318) is 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine is FC(F)(F)c1cc(-c2ccc(Cl)c(Cl)c2)nc(-n2cnc(-c3cccnc3)c2)n1.
What is the InChIKey of 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The InChIKey is HJOHWVOSWVTEHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10Cl2F3N5/c20-13-4-3-11(6-14(13)21)15-7-17(19(22,23)24)28-18(27-15)29-9-16(26-10-29)12-2-1-5-25-8-12/h1-10H.
What are the key properties of 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine?
4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine has a molecular weight of 436.22 g/mol, XLogP of 5.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)-2-(4-pyridin-3-ylimidazol-1-yl)-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 141185318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).