C20H26N2O4Si — CID 14118539
4,12-diphenyl-1,7,9,15-tetraoxa-4,12-diaza-8-silaspiro[7.7]pentadecane (PubChem CID 14118539) has the molecular formula C20H26N2O4Si and a molecular weight of 386.52 g/mol. Its IUPAC name is 4,12-diphenyl-1,7,9,15-tetraoxa-4,12-diaza-8-silaspiro[7.7]pentadecane.
| Compound Name | 4,12-diphenyl-1,7,9,15-tetraoxa-4,12-diaza-8-silaspiro[7.7]pentadecane |
|---|---|
| PubChem CID | 14118539 |
| Molecular Formula | C20H26N2O4Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4,12-diphenyl-1,7,9,15-tetraoxa-4,12-diaza-8-silaspiro[7.7]pentadecane |
| SMILES | c1ccc(N2CCO[Si]3(OCC2)OCCN(c2ccccc2)CCO3)cc1 |
| InChI | InChI=1S/C20H26N2O4Si/c1-3-7-19(8-4-1)21-11-15-23-27(24-16-12-21)25-17-13-22(14-18-26-27)20-9-5-2-6-10-20/h1-10H,11-18H2 |
| InChIKey | PJPGEEZGWVTRQG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|