About 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid
9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid (PubChem CID 141185501) has the molecular formula C17H27NO4
and a molecular weight of 309.41 g/mol. Its IUPAC name is 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid.
Molecular Properties
| Compound Name | 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid |
| PubChem CID | 141185501 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid |
| SMILES | CC1(C)C(=O)N(C2C3CCCC2CC(C(=O)O)C3)CC1CO |
| InChI | InChI=1S/C17H27NO4/c1-17(2)13(9-19)8-18(16(17)22)14-10-4-3-5-11(14)7-12(6-10)15(20)21/h10-14,19H,3-9H2,1-2H3,(H,20,21) |
| InChIKey | SZJFAZBBQZCLJI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid?
The IUPAC name of 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid (CID 141185501) is 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid.
What is the SMILES notation for 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid?
The canonical SMILES for 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid is CC1(C)C(=O)N(C2C3CCCC2CC(C(=O)O)C3)CC1CO.
What is the InChIKey of 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid?
The InChIKey is SZJFAZBBQZCLJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO4/c1-17(2)13(9-19)8-18(16(17)22)14-10-4-3-5-11(14)7-12(6-10)15(20)21/h10-14,19H,3-9H2,1-2H3,(H,20,21).
What are the key properties of 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid?
9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid has a molecular weight of 309.41 g/mol, XLogP of 1.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(hydroxymethyl)-3,3-dimethyl-2-oxopyrrolidin-1-yl]bicyclo[3.3.1]nonane-3-carboxylic acid is sourced from PubChem (CID 141185501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).