C14H14N4O2 — CID 141186122
2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridine (PubChem CID 141186122) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridine.
| Compound Name | 2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 141186122 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(3-piperidin-4-yl-1,2,4-oxadiazol-5-yl)furo[2,3-c]pyridine |
| SMILES | c1cc2cc(-c3nc(C4CCNCC4)no3)oc2cn1 |
| InChI | InChI=1S/C14H14N4O2/c1-4-15-5-2-9(1)13-17-14(20-18-13)11-7-10-3-6-16-8-12(10)19-11/h3,6-9,15H,1-2,4-5H2 |
| InChIKey | NJTBIWGZEULRGW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |