About 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol
2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol (PubChem CID 141186331) has the molecular formula C7H4Cl5NO
and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol.
Molecular Properties
| Compound Name | 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol |
| PubChem CID | 141186331 |
| Molecular Formula | C7H4Cl5NO |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 292.87 |
| IUPAC Name | 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol |
| SMILES | NC(Cl)c1c(O)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7H4Cl5NO/c8-2-1(7(12)13)6(14)5(11)4(10)3(2)9/h7,14H,13H2 |
| InChIKey | ULFGXKCNUSLTQV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol?
The IUPAC name of 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol (CID 141186331) is 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol.
What is the SMILES notation for 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol?
The canonical SMILES for 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol is NC(Cl)c1c(O)c(Cl)c(Cl)c(Cl)c1Cl.
What is the InChIKey of 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol?
The InChIKey is ULFGXKCNUSLTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl5NO/c8-2-1(7(12)13)6(14)5(11)4(10)3(2)9/h7,14H,13H2.
What are the key properties of 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol?
2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol has a molecular weight of 295.38 g/mol, XLogP of 4.20, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino(chloro)methyl]-3,4,5,6-tetrachlorophenol is sourced from PubChem (CID 141186331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).