C16H28O5S2 — CID 141186625
2-[4-hydroxy-2-oxo-6-[3-(3-propylsulfanylpropylsulfanyl)propyl]oxan-4-yl]acetic acid (PubChem CID 141186625) has the molecular formula C16H28O5S2 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-[4-hydroxy-2-oxo-6-[3-(3-propylsulfanylpropylsulfanyl)propyl]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-hydroxy-2-oxo-6-[3-(3-propylsulfanylpropylsulfanyl)propyl]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 141186625 |
| Molecular Formula | C16H28O5S2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[4-hydroxy-2-oxo-6-[3-(3-propylsulfanylpropylsulfanyl)propyl]oxan-4-yl]acetic acid |
| SMILES | CCCSCCCSCCCC1CC(O)(CC(=O)O)CC(=O)O1 |
| InChI | InChI=1S/C16H28O5S2/c1-2-6-22-8-4-9-23-7-3-5-13-10-16(20,11-14(17)18)12-15(19)21-13/h13,20H,2-12H2,1H3,(H,17,18) |
| InChIKey | IQXDLXUEVZZMLW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|