About 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole
3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole (PubChem CID 141186788) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole.
Molecular Properties
| Compound Name | 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole |
| PubChem CID | 141186788 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole |
| SMILES | C1=CN(ON2C=COC2)CO1 |
| InChI | InChI=1S/C6H8N2O3/c1-3-9-5-7(1)11-8-2-4-10-6-8/h1-4H,5-6H2 |
| InChIKey | NXRZKGGVMMFNQG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole?
The IUPAC name of 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole (CID 141186788) is 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole.
What is the SMILES notation for 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole?
The canonical SMILES for 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole is C1=CN(ON2C=COC2)CO1.
What is the InChIKey of 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole?
The InChIKey is NXRZKGGVMMFNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-3-9-5-7(1)11-8-2-4-10-6-8/h1-4H,5-6H2.
What are the key properties of 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole?
3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole has a molecular weight of 156.14 g/mol, XLogP of 0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-1,3-oxazol-3-yloxy)-2H-1,3-oxazole is sourced from PubChem (CID 141186788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).